CAS 869943-34-0

5-Fluoro-2-(3-pyridinyloxy)benzenamine

Description:

5-Fluoro-2-(3-pyridinyloxy)benzenamine is a chemical compound characterized by its aromatic structure, which includes a fluorine atom and a pyridinyloxy group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The pyridinyloxy moiety contributes to the compound's potential as a ligand in various chemical and biological interactions. This compound may exhibit properties such as moderate to high solubility in organic solvents, depending on the specific functional groups and their arrangement. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's unique characteristics may allow for interactions with various receptors or enzymes, making it a candidate for further research in drug discovery and development. As with many compounds containing nitrogen and fluorine, it is essential to consider safety and handling protocols due to potential toxicity or reactivity.

Formula: C₁₁H₉FN₂O

InChI: InChI=1S/C11H9FN2O/c12-8-3-4-11(10(13)6-8)15-9-2-1-5-14-7-9/h1-7H,13H2

InChI key: InChIKey=MHJLPCRMORFLNR-UHFFFAOYSA-N

SMILES: O(C1=C(N)C=C(F)C=C1)C=2C=CC=NC2

Synonyms:

• 5-Fluoro-2-(3-pyridinyloxy)benzenamine
• Benzenamine, 5-fluoro-2-(3-pyridinyloxy)-