CymitQuimica logo

CAS 869943-40-8

:

3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid

Description:
3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety linked to a thiadiazole ring. The presence of the thiadiazole group imparts specific biological and chemical properties, often associated with potential pharmacological activities. This compound features a sulfur atom in its structure, contributing to its reactivity and potential applications in medicinal chemistry. The methyl group on the thiadiazole ring can influence the compound's lipophilicity and solubility, affecting its bioavailability. Additionally, the carboxylic acid functional group provides acidic characteristics, allowing for interactions with biological systems. Overall, this compound's structural features suggest it may be of interest in the development of agrochemicals or pharmaceuticals, particularly in areas where sulfur-containing compounds exhibit beneficial effects. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C6H8N2O2S2
InChI:InChI=1/C6H8N2O2S2/c1-4-7-8-6(12-4)11-3-2-5(9)10/h2-3H2,1H3,(H,9,10)
SMILES:Cc1nnc(SCCC(=O)O)s1
Synonyms:
  • Propanoic Acid, 3-[(5-Methyl-1,3,4-Thiadiazol-2-Yl)Thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.