CymitQuimica logo

CAS 869943-49-7

:

4-[(furan-2-ylmethyl)sulfanyl]aniline

Description:
4-[(Furan-2-ylmethyl)sulfanyl]aniline, with the CAS number 869943-49-7, is an organic compound characterized by the presence of both an aniline group and a furan moiety linked through a sulfanyl (thioether) functional group. This compound typically exhibits properties associated with both aromatic amines and sulfur-containing compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the aniline nitrogen, which can participate in various chemical reactions, including electrophilic substitutions. The furan ring contributes to the compound's aromaticity and may influence its electronic properties, potentially making it a candidate for applications in organic synthesis or as a building block in pharmaceuticals. Additionally, the sulfanyl group can enhance the compound's nucleophilicity, allowing for further functionalization. Overall, this compound's unique structure may lead to interesting biological activities, although specific biological data would require further investigation.
Formula:C11H11NOS
InChI:InChI=1/C11H11NOS/c12-9-3-5-11(6-4-9)14-8-10-2-1-7-13-10/h1-7H,8,12H2
SMILES:c1cc(CSc2ccc(cc2)N)oc1
Synonyms:
  • 4-[(2-Furylmethyl)sulfanyl]aniline
  • Benzenamine, 4-[(2-Furanylmethyl)Thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.