CymitQuimica logo

CAS 869943-98-6

:

2,4-Dihydro-4-methyl-5-[(1-methyl-1H-pyrrol-2-yl)methyl]-3H-1,2,4-triazole-3-thione

Description:
2,4-Dihydro-4-methyl-5-[(1-methyl-1H-pyrrol-2-yl)methyl]-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of a pyrrole moiety, specifically a 1-methyl-1H-pyrrol-2-yl group, suggests that the compound may exhibit interesting pharmacological properties, as pyrrole derivatives are often associated with various biological activities. The compound's structure implies it may be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. As a triazole derivative, it may also possess fungicidal or herbicidal properties, making it of interest in agricultural chemistry. However, specific applications and safety profiles would require further investigation and analysis.
Formula:C9H12N4S
InChI:InChI=1S/C9H12N4S/c1-12-5-3-4-7(12)6-8-10-11-9(14)13(8)2/h3-5H,6H2,1-2H3,(H,11,14)
InChI key:InChIKey=KPQVGQLSCPQVCU-UHFFFAOYSA-N
SMILES:C(C=1N(C)C(=S)NN1)C=2N(C)C=CC2
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-methyl-5-[(1-methyl-1H-pyrrol-2-yl)methyl]-
  • 2,4-Dihydro-4-methyl-5-[(1-methyl-1H-pyrrol-2-yl)methyl]-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.