CymitQuimica logo

CAS 869944-85-4

:

N-Cyclooctyltetrahydro-2-furanmethanamine

Description:
N-Cyclooctyltetrahydro-2-furanmethanamine is a chemical compound characterized by its unique structure, which includes a cyclooctyl group and a tetrahydrofuran ring. This compound is classified as an amine due to the presence of an amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The tetrahydrofuran moiety contributes to its potential solubility in organic solvents, while the cyclooctyl group may influence its steric properties and overall reactivity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Additionally, the presence of the furan ring may impart specific electronic properties, making it a candidate for further research in organic synthesis and material science. As with many amines, it is important to consider its safety and handling protocols, as amines can be reactive and may pose health risks if not managed properly.
Formula:C13H25NO
InChI:InChI=1S/C13H25NO/c1-2-4-7-12(8-5-3-1)14-11-13-9-6-10-15-13/h12-14H,1-11H2
InChI key:InChIKey=NJQJHPYXHMGKHZ-UHFFFAOYSA-N
SMILES:N(CC1CCCO1)C2CCCCCCC2
Synonyms:
  • N-Cyclooctyltetrahydro-2-furanmethanamine
  • 2-Furanmethanamine, N-cyclooctyltetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.