CAS 869945-23-3

1-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)methanamine

Description:

1-(4-fluorophenyl)-N-(pyridin-4-ylmethyl)methanamine, with the CAS number 869945-23-3, is an organic compound characterized by its complex structure, which includes a fluorophenyl group and a pyridinylmethyl moiety. This compound features a primary amine functional group, which contributes to its reactivity and potential interactions in biological systems. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its pharmacokinetic profile. The pyridine ring adds to the compound's aromatic character and may participate in hydrogen bonding or coordination with metal ions. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, where modifications to the aromatic and amine groups can lead to variations in biological activity. Its solubility, stability, and reactivity can be influenced by the specific functional groups present, making it a subject of study in various chemical and pharmaceutical contexts.

Formula: C₁₃H₁₃FN₂

InChI: InChI=1/C13H13FN2/c14-13-3-1-11(2-4-13)9-16-10-12-5-7-15-8-6-12/h1-8,16H,9-10H2

SMILES: c1cc(ccc1CNCc1ccncc1)F

Synonyms:

• 4-pyridinemethanamine, N-[(4-fluorophenyl)methyl]-