
CAS 869945-31-3
:2-(2-Fluorophenoxy)benzenemethanamine
Description:
2-(2-Fluorophenoxy)benzenemethanamine, identified by its CAS number 869945-31-3, is an organic compound characterized by the presence of both an amine group and a fluorophenoxy moiety. This compound features a benzene ring substituted with a fluorophenoxy group, which enhances its lipophilicity and may influence its biological activity. The amine functional group contributes to its potential as a ligand in various chemical reactions and interactions. The presence of the fluorine atom can affect the compound's electronic properties, potentially increasing its reactivity and altering its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could facilitate interactions with specific receptors or enzymes. Additionally, its solubility and stability in various solvents can be influenced by the substituents on the aromatic rings. Overall, 2-(2-Fluorophenoxy)benzenemethanamine represents a class of compounds that may exhibit diverse chemical and biological properties.
Formula:C13H12FNO
InChI:InChI=1S/C13H12FNO/c14-11-6-2-4-8-13(11)16-12-7-3-1-5-10(12)9-15/h1-8H,9,15H2
InChI key:InChIKey=XXDIHNKOCHOMLH-UHFFFAOYSA-N
SMILES:O(C1=C(CN)C=CC=C1)C2=C(F)C=CC=C2
Synonyms:- (2-(2-Fluorophenoxy)phenyl)methanamine
- 2-(2-Fluorophenoxy)benzenemethanamine
- Benzenemethanamine, 2-(2-fluorophenoxy)-
- [2-(2-Fluorophenoxy)phenyl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.