CAS 869945-34-6

(2E)-3-phenyl-N-(tetrahydrofuran-2-ylmethyl)prop-2-en-1-amine

Description:

(2E)-3-phenyl-N-(tetrahydrofuran-2-ylmethyl)prop-2-en-1-amine is an organic compound characterized by its unique structure, which includes a prop-2-en-1-amine backbone with a phenyl group and a tetrahydrofuran moiety. The presence of the double bond in the prop-2-en-1-amine structure contributes to its reactivity, making it a potential candidate for various chemical reactions, including addition and substitution reactions. The tetrahydrofuran ring introduces a cyclic ether component, which can influence the compound's solubility and polarity. This compound may exhibit biological activity due to its amine functionality, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a versatile structure with potential implications in various fields of chemistry and pharmacology.

Formula: C₁₄H₁₉NO

InChI: InChI=1/C14H19NO/c1-2-6-13(7-3-1)8-4-10-15-12-14-9-5-11-16-14/h1-4,6-8,14-15H,5,9-12H2/b8-4+

Synonyms:

• ((E)-3-Phenyl-allyl)-(tetrahydro-furan-2-ylmethyl)-amine
• 2-furanmethanamine, tetrahydro-N-[(2E)-3-phenyl-2-propen-1-yl]-