CAS 869945-40-4
:4-cyclopropyl-2-hydrazino-6-(trifluoromethyl)pyrimidine
Description:
4-Cyclopropyl-2-hydrazino-6-(trifluoromethyl)pyrimidine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a cyclopropyl group, a hydrazino group, and a trifluoromethyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The hydrazino group can participate in various chemical reactions, including those involving hydrazone formation, which is significant in medicinal chemistry. Additionally, the cyclopropyl moiety can impart strain and reactivity, potentially affecting the compound's interaction with biological targets. This compound may exhibit specific pharmacological properties, and its synthesis and characterization are essential for understanding its potential applications in drug development. As with many heterocyclic compounds, the electronic and steric effects of the substituents play a crucial role in determining the compound's reactivity and biological profile. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C8H9F3N4
InChI:InChI=1/C8H9F3N4/c9-8(10,11)6-3-5(4-1-2-4)13-7(14-6)15-12/h3-4H,1-2,12H2,(H,13,14,15)
SMILES:C1CC1c1cc(C(F)(F)F)nc(n1)NN
Synonyms:- (2E)-6-Cyclopropyl-2-hydrazono-4-(trifluoromethyl)-1,2-dihydropyrimidine
- 2(1H)-pyrimidinone, 6-cyclopropyl-4-(trifluoromethyl)-, hydrazone, (2E)-
- Pyrimidine, 4-cyclopropyl-2-hydrazinyl-6-(trifluoromethyl)-
- 4-cyclopropyl-2-hydrazinyl-6-(trifluoromethyl)Pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Cyclopropyl-2-hydrazono-4-(trifluoromethyl)-1,2-dihydropyrimidine
CAS:Formula:C8H9F3N4Molecular weight:218.1791
