CAS 869947-15-9

2-(2-Chloro-5-methylphenoxy)butanoic acid

Description:

2-(2-Chloro-5-methylphenoxy)butanoic acid, identified by its CAS number 869947-15-9, is a synthetic organic compound that belongs to the class of phenoxy acids. This substance features a butanoic acid backbone substituted with a phenoxy group, specifically a 2-chloro-5-methylphenyl moiety. The presence of the chlorine atom and the methyl group on the aromatic ring contributes to its unique chemical properties, including potential herbicidal activity. The compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many phenoxy acids. Its structure allows for interactions with biological systems, making it of interest in agricultural applications, particularly as a plant growth regulator or herbicide. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity and environmental impact. Overall, 2-(2-Chloro-5-methylphenoxy)butanoic acid exemplifies the diverse functionality of phenoxy compounds in chemical and agricultural chemistry.

Formula: C₁₁H₁₃ClO₃

InChI: InChI=1S/C11H13ClO3/c1-3-9(11(13)14)15-10-6-7(2)4-5-8(10)12/h4-6,9H,3H2,1-2H3,(H,13,14)

InChI key: InChIKey=IBEUMMWJCKGJFT-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)CC)C1=C(Cl)C=CC(C)=C1

Synonyms:

• Butanoic acid, 2-(2-chloro-5-methylphenoxy)-
• 2-(2-Chloro-5-methylphenoxy)butanoic acid