CAS 869947-18-2

7-(2-Furanyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

7-(2-Furanyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its unique structural features, which include a pyrazolo-pyrimidine core fused with a furan ring. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the carboxylic acid functional group suggests it may participate in various chemical reactions, such as esterification or amidation, and can influence its solubility and reactivity. The furan moiety contributes to its aromatic character, potentially enhancing its interaction with biological targets. Additionally, the compound's molecular structure may allow for hydrogen bonding and π-π stacking interactions, which are important in drug design and development. Overall, 7-(2-Furanyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid represents a versatile scaffold for further chemical modifications aimed at optimizing its pharmacological properties.

Formula: C₁₁H₇N₃O₃

InChI: InChI=1S/C11H7N3O3/c15-11(16)7-6-13-14-8(3-4-12-10(7)14)9-2-1-5-17-9/h1-6H,(H,15,16)

InChI key: InChIKey=NQUFOVSCCDKNAV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(C(=CC=N2)C3=CC=CO3)N=C1

Synonyms:

• 7-(2-Furanyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 7-(2-furanyl)-

7-Furan-2-yl-pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 869947-18-2

Versatile small molecule scaffold

Formula: C₁₁H₇N₃O₃

Purity: Min. 95%

Molecular weight: 229.2 g/mol

Ref: 3D-UJB94718