CAS 869947-19-3

7-(2-Furanyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:

7-(2-Furanyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic compound characterized by its unique structural features, which include a pyrazolo-pyrimidine core fused with a furan ring. This compound typically exhibits properties associated with both aromatic and heteroaromatic systems, contributing to its potential biological activity. The presence of the carboxylic acid functional group suggests it may engage in hydrogen bonding and participate in various chemical reactions, enhancing its solubility in polar solvents. Additionally, the furan moiety can contribute to the compound's reactivity and stability under certain conditions. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory or anti-cancer activities, although specific biological data would be necessary to confirm such effects. Its unique structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. As with many heterocycles, the compound's properties can be influenced by substituents and the overall molecular environment.

Formula: C₁₁H₇N₃O₃

InChI: InChI=1S/C11H7N3O3/c15-11(16)7-6-10-12-4-3-8(14(10)13-7)9-2-1-5-17-9/h1-6H,(H,15,16)

InChI key: InChIKey=WVANFBWIAZCONH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN2C(=CC=NC2=C1)C3=CC=CO3

Synonyms:

• 7-(2-Furanyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 7-(2-furanyl)-

7-Furan-2-yl-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 869947-19-3

Versatile small molecule scaffold

Formula: C₁₁H₇N₃O₃

Purity: Min. 95%

Molecular weight: 229.19 g/mol

Ref: 3D-UJB94719