CAS 869947-40-0

7-(Trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:

7-(Trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic organic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a trifluoromethyl group at the 7-position and a carboxylic acid functional group at the 2-position. This compound exhibits notable properties due to the presence of the trifluoromethyl group, which enhances its lipophilicity and can influence its biological activity. The carboxylic acid moiety contributes to its acidity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications in medicinal chemistry. The compound's structure allows for potential interactions with biological targets, which may lead to pharmacological effects. Additionally, its stability and solubility characteristics can vary based on the solvent and conditions used. Overall, 7-(Trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is of interest in research for its potential applications in drug development and as a building block in organic synthesis.

Formula: C₈H₄F₃N₃O₂

InChI: InChI=1S/C8H4F3N3O2/c9-8(10,11)5-1-2-12-6-3-4(7(15)16)13-14(5)6/h1-3H,(H,15,16)

InChI key: InChIKey=BGZWQYQWZNUOJO-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(=CC(C(O)=O)=N2)N=CC1

Synonyms:

• 7-(Trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 7-(trifluoromethyl)-

7-Trifluoromethyl-pyrazolo[1,5- a ]pyrimidine-2-carboxylic acid

CAS: 869947-40-0

Formula: C₈H₄F₃N₃O₂

Color and Shape: Solid

Molecular weight: 231.134

Ref: 10-F027913