CAS 869947-44-4

3-Acetyl-1H-indole-1-propanoic acid

Description:

3-Acetyl-1H-indole-1-propanoic acid, with the CAS number 869947-44-4, is a chemical compound that features a fused indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of an acetyl group and a propanoic acid moiety, contributing to its unique chemical properties. It typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic indole structure. The presence of functional groups such as the acetyl and carboxylic acid groups allows for potential reactivity, including esterification and acylation reactions. Additionally, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The indole framework is known for its role in various biological systems, and derivatives can have applications in medicinal chemistry. Overall, 3-Acetyl-1H-indole-1-propanoic acid represents a versatile structure with potential implications in both synthetic and medicinal chemistry.

Formula: C₁₃H₁₃NO₃

InChI: InChI=1S/C13H13NO3/c1-9(15)11-8-14(7-6-13(16)17)12-5-3-2-4-10(11)12/h2-5,8H,6-7H2,1H3,(H,16,17)

InChI key: InChIKey=DWVWXXMZRUKODS-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=2C(N(CCC(O)=O)C1)=CC=CC2

Synonyms:

• 3-Acetyl-1H-indole-1-propanoic acid
• 1H-Indole-1-propanoic acid, 3-acetyl-

3-(3-Acetyl-1H-indol-1-yl)propanoic acid

Controlled Product

CAS: 869947-44-4

Please enquire for more information about 3-(3-Acetyl-1H-indol-1-yl)propanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₃NO₃

Purity: Min. 95%

Molecular weight: 231.25 g/mol

Ref: 3D-FA124462