CAS 869947-84-2

3-[(thiophen-2-ylmethyl)amino]benzoic acid

Description:

3-[(Thiophen-2-ylmethyl)amino]benzoic acid, identified by its CAS number 869947-84-2, is an organic compound characterized by the presence of both a benzoic acid moiety and a thiophene ring. This compound features an amino group that is substituted with a thiophen-2-ylmethyl group, which contributes to its unique chemical properties. The benzoic acid portion provides acidic characteristics due to the carboxylic acid functional group, while the thiophene ring introduces aromaticity and potential for various interactions, such as π-π stacking and hydrogen bonding. The presence of the thiophene group may also enhance the compound's solubility in organic solvents and influence its reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, 3-[(thiophen-2-ylmethyl)amino]benzoic acid is a versatile compound with significant implications in various chemical and biological contexts.

Formula: C₁₂H₁₁NO₂S

InChI: InChI=1/C12H11NO2S/c14-12(15)9-3-1-4-10(7-9)13-8-11-5-2-6-16-11/h1-7,13H,8H2,(H,14,15)

SMILES: c1cc(cc(c1)NCc1cccs1)C(=O)O

Synonyms:

• 3-[(2-Thienylmethyl)amino]benzoic acid
• Benzoic Acid, 3-[(2-Thienylmethyl)Amino]-

3-[(2-thienylmethyl)amino]benzoic acid

CAS: 869947-84-2

Formula: C₁₂H₁₁NO₂S

Purity: 95.0%

Molecular weight: 233.29

Ref: 10-F315810