CAS 869947-87-5

N-Methyl-4-(2-thienylmethoxy)benzenemethanamine

Description:

N-Methyl-4-(2-thienylmethoxy)benzenemethanamine, identified by its CAS number 869947-87-5, is a chemical compound that features a complex structure comprising a benzene ring substituted with a thienylmethoxy group and a methylamino group. This compound is characterized by its potential biological activity, which may include interactions with various neurotransmitter systems, making it of interest in pharmacological research. The presence of the thienyl group contributes to its unique electronic properties and may influence its solubility and reactivity. Additionally, the methylamino group can enhance its lipophilicity, potentially affecting its ability to cross biological membranes. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions are essential when working with this compound, as it may exhibit toxicity or other hazardous properties. Overall, N-Methyl-4-(2-thienylmethoxy)benzenemethanamine represents a compound of interest in medicinal chemistry and drug development.

Formula: C₁₃H₁₅NOS

InChI: InChI=1S/C13H15NOS/c1-14-9-11-4-6-12(7-5-11)15-10-13-3-2-8-16-13/h2-8,14H,9-10H2,1H3

InChI key: InChIKey=TUBYPRWSBDQWQL-UHFFFAOYSA-N

SMILES: O(CC1=CC=CS1)C2=CC=C(CNC)C=C2

Synonyms:

• N-Methyl-4-(2-thienylmethoxy)benzenemethanamine
• Benzenemethanamine, N-methyl-4-(2-thienylmethoxy)-
• N-methyl-1-[4-(thiophen-2-ylmethoxy)phenyl]methanamine
• N-methyl-N-[4-(2-thienylmethoxy)benzyl]amine
• methyl({[4-(thiophen-2-ylmethoxy)phenyl]methyl})amine

Methyl({[4-(thiophen-2-ylmethoxy)phenyl]methyl})amine

CAS: 869947-87-5

Versatile small molecule scaffold

Formula: C₁₃H₁₅NOS

Purity: Min. 95%

Molecular weight: 233.33 g/mol

Ref: 3D-UJB94787