CAS 869947-98-8

2-[(5,6,7,8-Tetrahydro-2-naphthalenyl)oxy]butanoic acid

Description:

2-[(5,6,7,8-Tetrahydro-2-naphthalenyl)oxy]butanoic acid, with the CAS number 869947-98-8, is an organic compound characterized by its unique structure that includes a butanoic acid moiety linked to a tetrahydronaphthalene derivative via an ether bond. This compound typically exhibits properties associated with both hydrophobic and hydrophilic regions due to the presence of the naphthalene ring and the carboxylic acid functional group. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a biochemical probe, given its structural complexity. The presence of the tetrahydronaphthalene moiety may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, which may affect its interactions in biological systems. Overall, this compound represents a class of organic molecules that could have significant implications in drug development and chemical research.

Formula: C₁₄H₁₈O₃

InChI: InChI=1/C14H18O3/c1-2-13(14(15)16)17-12-8-7-10-5-3-4-6-11(10)9-12/h7-9,13H,2-6H2,1H3,(H,15,16)

InChI key: InChIKey=YMERGXVWLWRYGI-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)CC)C=1C=C2C(=CC1)CCCC2

Synonyms:

• 2-[(5,6,7,8-Tetrahydro-2-naphthalenyl)oxy]butanoic acid
• Butanoic acid, 2-[(5,6,7,8-tetrahydro-2-naphthalenyl)oxy]-

2-(5,6,7,8-tetrahydro-2-naphthalenyloxy)butanoic acid

CAS: 869947-98-8

Formula: C₁₄H₁₈O₃

Purity: 95.0%

Molecular weight: 234.295

Ref: 10-F315979