CymitQuimica logo

CAS 869948-07-2

:

4-(2-azepan-1-ylethoxy)aniline

Description:
4-(2-Azepan-1-ylethoxy)aniline is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a phenyl ring. The presence of the azepane moiety, a seven-membered saturated nitrogen-containing ring, contributes to its unique properties, including potential for hydrogen bonding and increased solubility in polar solvents. This compound typically exhibits moderate to high stability under standard conditions, although its reactivity can be influenced by the functional groups present. The ethoxy group (-OCH2CH3) enhances its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. As a result, 4-(2-azepan-1-ylethoxy)aniline may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and toxicity profiles. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and application.
Formula:C14H22N2O
InChI:InChI=1/C14H22N2O/c15-13-5-7-14(8-6-13)17-12-11-16-9-3-1-2-4-10-16/h5-8H,1-4,9-12,15H2
SMILES:C1CCCN(CC1)CCOc1ccc(cc1)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.