CAS 869948-08-3

4,5,6,7-Tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

4,5,6,7-Tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a trifluoromethyl group. This compound features a bicyclic framework that includes a saturated tetrahydro segment, contributing to its stability and potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. The trifluoromethyl group is known for imparting lipophilicity and can influence the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. This compound may exhibit various biological activities, potentially acting as an inhibitor or modulator in biochemical pathways. Its specific applications and efficacy would depend on further research and characterization, including studies on its interaction with biological targets. Overall, this compound represents a class of molecules that could have significant implications in drug development and therapeutic applications.

Formula: C₈H₈F₃N₃O₂

InChI: InChI=1S/C8H8F3N3O2/c9-8(10,11)5-1-2-12-6-4(7(15)16)3-13-14(5)6/h3,5,12H,1-2H2,(H,15,16)

InChI key: InChIKey=NIAZXMDUIWSZGJ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1N2C(=C(C(O)=O)C=N2)NCC1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 4,5,6,7-tetrahydro-7-(trifluoromethyl)-
• 4,5,6,7-Tetrahydro-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

7-(Trifluoromethyl)-4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 869948-08-3

Versatile small molecule scaffold

Formula: C₈H₈F₃N₃O₂

Purity: Min. 95%

Molecular weight: 235.16 g/mol

Ref: 3D-UJB94808