CAS 869948-84-5
:2-(3-Methyl-4-nitrophenoxy)butanoic acid
Description:
2-(3-Methyl-4-nitrophenoxy)butanoic acid is an organic compound characterized by its unique structure, which includes a butanoic acid moiety linked to a phenoxy group that is further substituted with a methyl and a nitro group. This compound typically exhibits properties associated with both carboxylic acids and aromatic compounds, including potential acidity due to the carboxylic acid functional group and hydrophobic characteristics from the aromatic ring. The presence of the nitro group introduces electron-withdrawing properties, which can influence the compound's reactivity and polarity. It may be soluble in organic solvents while exhibiting limited solubility in water, depending on the pH and the presence of other functional groups. This compound could be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and role as an intermediate in synthetic pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H13NO5
InChI:InChI=1S/C11H13NO5/c1-3-10(11(13)14)17-8-4-5-9(12(15)16)7(2)6-8/h4-6,10H,3H2,1-2H3,(H,13,14)
InChI key:InChIKey=JCYZYNZBXPNNEZ-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)CC)C1=CC(C)=C(N(=O)=O)C=C1
Synonyms:- 2-(3-Methyl-4-nitrophenoxy)butanoic acid
- Butanoic acid, 2-(3-methyl-4-nitrophenoxy)-
- ART-CHEM-BB B013873
- AKOS B013873
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.