CAS 869949-75-7

N-(5-bromo-2-methoxybenzyl)ethanamine

Description:

N-(5-bromo-2-methoxybenzyl)ethanamine is an organic compound characterized by its structure, which includes a benzyl group substituted with a bromine atom and a methoxy group, along with an ethanamine moiety. This compound features a bromine atom at the 5-position of the benzene ring, which can influence its reactivity and biological activity. The methoxy group, located at the 2-position, enhances the compound's lipophilicity and may affect its interaction with biological targets. The ethanamine part of the molecule introduces an amine functional group, which can participate in hydrogen bonding and may contribute to the compound's solubility in polar solvents. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and biological activities would depend on further studies and evaluations. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with brominated compounds.

Formula: C₁₀H₁₄BrNO

InChI: InChI=1/C10H14BrNO/c1-3-12-7-8-6-9(11)4-5-10(8)13-2/h4-6,12H,3,7H2,1-2H3

SMILES: CCNCc1cc(ccc1OC)Br