CAS 869949-98-4

2-(3-acetylindol-1-yl)butanoic acid

Description:

2-(3-Acetylindol-1-yl)butanoic acid, with the CAS number 869949-98-4, is a chemical compound that features both an indole moiety and a butanoic acid functional group. This compound is characterized by its structural complexity, which includes an acetyl group attached to the indole ring, contributing to its potential biological activity. The presence of the butanoic acid portion suggests that it may exhibit properties typical of carboxylic acids, such as acidity and the ability to form salts or esters. The indole structure is known for its role in various biological processes and can influence the compound's interaction with biological targets. Additionally, the compound may possess unique solubility characteristics due to the combination of hydrophilic (carboxylic acid) and hydrophobic (indole) regions. Its potential applications could span medicinal chemistry, particularly in drug development, where indole derivatives are often explored for their pharmacological properties. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through experimental studies.

Formula: C₁₄H₁₅NO₃

InChI: InChI=1/C14H15NO3/c1-3-12(14(17)18)15-8-11(9(2)16)10-6-4-5-7-13(10)15/h4-8,12H,3H2,1-2H3,(H,17,18)

InChI key: InChIKey=WONGCYPXRDVLEE-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CC)N1C=2C(C(C(C)=O)=C1)=CC=CC2

Synonyms:

• 2-(3-Acetyl-1H-indol-1-yl)butanoic acid
• 3-Acetyl-α-ethyl-1H-indole-1-acetic acid
• 1H-Indole-1-acetic acid, 3-acetyl-α-ethyl-
• 2-(3-Acetyl-indol-1-yl)-butyric acid

2-(3-acetyl-1H-indol-1-yl)butanoic acid

Controlled Product

CAS: 869949-98-4

Please enquire for more information about 2-(3-acetyl-1H-indol-1-yl)butanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₅NO₃

Purity: Min. 95%

Molecular weight: 245.28 g/mol

Ref: 3D-UJB94998