CAS 869950-20-9

4-Methyl-2-(1-piperazinyl)-6-(trifluoromethyl)pyrimidine

Description:

4-Methyl-2-(1-piperazinyl)-6-(trifluoromethyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a methyl group at the 4-position and a trifluoromethyl group at the 6-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The piperazine moiety, attached at the 2-position, enhances the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trifluoromethyl group can impart significant electronic effects, influencing reactivity and stability. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting various biological pathways. As with many heterocyclic compounds, it may also exhibit interesting properties such as fluorescence or specific reactivity patterns, which can be explored in further research.

Formula: C₁₀H₁₃F₃N₄

InChI: InChI=1S/C10H13F3N4/c1-7-6-8(10(11,12)13)16-9(15-7)17-4-2-14-3-5-17/h6,14H,2-5H2,1H3

InChI key: InChIKey=VYJXARJVRTWEKS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=NC(=NC(C)=C1)N2CCNCC2

Synonyms:

• Pyrimidine, 4-methyl-2-(1-piperazinyl)-6-(trifluoromethyl)-
• 4-Methyl-2-(1-piperazinyl)-6-(trifluoromethyl)pyrimidine