CymitQuimica logo

CAS 869950-77-6

:

2-chloro-5-[(chloroacetyl)amino]benzoic acid

Description:
2-Chloro-5-[(chloroacetyl)amino]benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a chloro group and a chloroacetylamino group. This compound features a chlorine atom at the 2-position and an amino group at the 5-position of the benzene ring, which is further substituted with a chloroacetyl group. The presence of these functional groups contributes to its potential reactivity and biological activity. As a benzoic acid derivative, it exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The chloroacetyl group can enhance the compound's electrophilicity, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit specific pharmacological properties, which could be of interest in medicinal chemistry. Its unique structure and functional groups suggest potential applications in drug development or as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of chlorine substituents, which can pose health risks.
Formula:C9H7Cl2NO3
InChI:InChI=1/C9H7Cl2NO3/c10-4-8(13)12-5-1-2-7(11)6(3-5)9(14)15/h1-3H,4H2,(H,12,13)(H,14,15)
SMILES:c1cc(c(cc1N=C(CCl)O)C(=O)O)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.