CAS 869951-15-5

4-bromo-5-propylthiophene-2-carboxylic acid

Description:

4-Bromo-5-propylthiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 4-position and a propyl group at the 5-position contributes to its unique chemical properties, including increased lipophilicity and potential for various chemical reactions. The carboxylic acid functional group at the 2-position imparts acidic characteristics, allowing for proton donation and participation in hydrogen bonding. This compound may exhibit interesting reactivity due to the electron-withdrawing effects of the bromine and the electron-donating nature of the propyl group, influencing its behavior in chemical reactions. Additionally, its structural features suggest potential applications in organic synthesis, materials science, or as a building block in pharmaceuticals. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, making it a subject of interest in both academic and industrial research.

Formula: C₈H₉BrO₂S

InChI: InChI=1/C8H9BrO2S/c1-2-3-6-5(9)4-7(12-6)8(10)11/h4H,2-3H2,1H3,(H,10,11)

SMILES: CCCc1c(cc(C(=O)O)s1)Br

Synonyms:

• 2-Thiophenecarboxylic Acid, 4-Bromo-5-Propyl-