CAS 869952-74-9

4-(Difluoromethyl)-6-(4-fluorophenyl)-2-hydrazinylpyrimidine

Description:

4-(Difluoromethyl)-6-(4-fluorophenyl)-2-hydrazinylpyrimidine, identified by its CAS number 869952-74-9, is a chemical compound that belongs to the class of pyrimidines, which are six-membered heterocyclic compounds containing nitrogen atoms. This particular compound features a difluoromethyl group and a 4-fluorophenyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of the hydrazinyl group indicates that it may exhibit reactivity typical of hydrazines, which can participate in various chemical reactions, including those involving nucleophilic attack. The fluorine atoms in the structure can enhance the compound's lipophilicity and influence its interaction with biological targets. Such modifications often lead to increased potency and selectivity in pharmaceutical applications. The compound's specific characteristics, such as solubility, stability, and reactivity, would depend on its molecular structure and the environment in which it is studied. Overall, this compound may have potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₁H₉F₃N₄

InChI: InChI=1S/C11H9F3N4/c12-7-3-1-6(2-4-7)8-5-9(10(13)14)17-11(16-8)18-15/h1-5,10H,15H2,(H,16,17,18)

InChI key: InChIKey=SPYHWIQCEGJKHN-UHFFFAOYSA-N

SMILES: C(F)(F)C=1C=C(NC(=NN)N1)C2=CC=C(F)C=C2

Synonyms:

• 2(1H)-Pyrimidinone, 4-(difluoromethyl)-6-(4-fluorophenyl)-, hydrazone
• Pyrimidine, 4-(difluoromethyl)-6-(4-fluorophenyl)-2-hydrazinyl-
• 4-(Difluoromethyl)-6-(4-fluorophenyl)-2-hydrazinylpyrimidine