
CAS 86996-27-2
:N-(2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)-4-methylbenzenesulfonamide
Description:
N-(2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)-4-methylbenzenesulfonamide, with CAS number 86996-27-2, is a complex organic compound characterized by its unique structural features, including a benzohexaoxacyclooctadecin core and a sulfonamide functional group. The presence of multiple oxygen atoms in its structure suggests potential for hydrogen bonding and solubility in polar solvents. The sulfonamide group typically enhances the compound's biological activity, making it of interest in medicinal chemistry. Its decahydro structure indicates a saturated framework, which may contribute to its stability and influence its interactions with biological targets. The compound's intricate arrangement of carbon and oxygen atoms may also affect its reactivity and potential applications in various fields, including pharmaceuticals and materials science. Overall, this substance exemplifies the complexity often found in synthetic organic compounds, highlighting the interplay between structure and function in chemical design.
Formula:C23H31NO8S
InChI:InChI=1S/C23H31NO8S/c1-19-2-5-21(6-3-19)33(25,26)24-20-4-7-22-23(18-20)32-17-15-30-13-11-28-9-8-27-10-12-29-14-16-31-22/h2-7,18,24H,8-17H2,1H3
InChI key:InChIKey=ZOIYTUYZWKAUDY-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=C(C)C=C1)C=2C=C3C(=CC2)OCCOCCOCCOCCOCCO3
Synonyms:- 1,4,7,10,13,16-Benzohexaoxacyclooctadecin, benzenesulfonamide deriv.
- Benzenesulfonamide, N-(2,3,5,6,8,9,11,12,14,15-decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)-4-methyl-
- N-(2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)-4-methylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenesulfonamide, N-(2,3,5,6,8,9,11,12,14,15-decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)-4-methyl-
CAS:Formula:C23H31NO8SMolecular weight:481.5591
