CAS 87-05-8
:7-Ethoxy-4-methylcoumarin
Description:
7-Ethoxy-4-methylcoumarin is an organic compound belonging to the coumarin family, characterized by its fused benzene and α-pyrone rings. It typically appears as a pale yellow to light brown crystalline solid. This compound is known for its fluorescent properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. Its molecular structure includes an ethoxy group at the 7-position and a methyl group at the 4-position of the coumarin ring, which influences its solubility and reactivity. 7-Ethoxy-4-methylcoumarin is often employed in the synthesis of other chemical compounds and can serve as a substrate in enzymatic reactions, particularly in studies involving cytochrome P450 enzymes. Additionally, it has been investigated for its potential biological activities, including antimicrobial and antioxidant properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C12H12O3
InChI:InChI=1S/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3
InChI key:InChIKey=NKRISXMDKXBVRJ-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC(OCC)=CC2)OC(=O)C1
Synonyms:- 2H-1-Benzopyran-2-one, 7-ethoxy-4-methyl-
- 4-Methyl-7-ethoxycoumarin
- 4-Methylumbelliferone ethyl ether
- 7-Ethoxy-4-methyl-2H-1-benzopyran-2-one
- 7-Ethoxy-4-methyl-2H-chromen-2-one
- Coumarin, 7-ethoxy-4-methyl-
- Ethyl 4-methylumbelliferyl ether
- NSC 60561
- 7-Ethoxy-4-methylcoumarin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
7-Ethoxy-4-methylcoumarin
CAS:Formula:C12H12O3Purity:>97.0%(GC)Color and Shape:White to Gray powder to crystalMolecular weight:204.237-Ethoxy-4-methyl-2H-chromen-2-one
CAS:Formula:C12H12O3Purity:98%Color and Shape:SolidMolecular weight:204.22197-Ethoxy-4-Methylcoumarin
CAS:<p>7-Ethoxy-4-Methylcoumarin</p>Purity:≥98%Molecular weight:204.22g/mol7-Ethoxy-4-methylcoumarin
CAS:<p>7-Ethoxy-4-methylcoumarin</p>Formula:C12H12O3Purity:98%Color and Shape: white to off-white crystalline solidMolecular weight:204.22g/mol7-Ethoxy-4-Methylcoumarin
CAS:<p>7-Ethoxy-4-Methylcoumarin: fragrant, organic, enzyme inhibitor; used in drug effect studies.</p>Formula:C12H12O3Purity:99.50%Color and Shape:SolidMolecular weight:204.227-Ethoxy-4-methylcoumarin
CAS:Controlled Product<p>Applications 7-Ethoxy-4-methylcoumarin (cas# 87-05-8) is a useful research chemical.<br></p>Formula:C12H12O3Color and Shape:NeatMolecular weight:204.227-Ethoxy-4-methylcoumarin
CAS:<p>7-Ethoxy-4-methylcoumarin is a fluorescent probe, which is a synthetic compound commonly sourced from organic chemical synthesis. With its distinct chromophore, this compound becomes highly fluorescent upon enzymatic cleavage, offering a reliable mechanism for the detection of specific enzymatic activities. The mode of action involves the enzymatic cleavage of the ethoxy group, leading to the release of 4-methylumbelliferone, a fluorescent product. This conversion provides a measurable signal that correlates with enzyme activity, making it an invaluable tool in studying enzyme kinetics.</p>Formula:C12H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:204.22 g/mol








