CAS 87-48-9
:5-Bromoisatin
Description:
5-Bromoisatin is an organic compound characterized by its structure, which includes a bromine atom substituted at the 5-position of the isatin framework. It has a molecular formula of C8H6BrN1O2, indicating the presence of a bromine atom, a carbonyl group, and an amine group within its structure. This compound typically appears as a yellow to orange crystalline solid and is known for its role in various chemical reactions, particularly in organic synthesis and medicinal chemistry. 5-Bromoisatin exhibits moderate solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. Its reactivity is influenced by the presence of the bromine atom, which can participate in electrophilic substitution reactions. Additionally, 5-Bromoisatin has been studied for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in pharmaceutical research. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H4BrNO2
InChI:InChI=1S/C8H4BrNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12)
InChI key:InChIKey=MBVCESWADCIXJN-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC1=O)=CC=C(Br)C2
Synonyms:- 1H-Indole-2,3-dione, 5-bromo-
- 5-Bromo-2,3-dihydro-1H-indole-2,3-dione
- 5-Bromo-2,3-indolinedione
- 5-Bromoindole-2,3-dione
- 5-Bromoindoline-2,3-Dione
- 5-Bromoisatin
- 5-Bromoisatine
- 5-bromo-1H-indole-2,3-dione
- Indole-2,3-dione, 5-bromo-
- Isatin, 5-bromo-
- NSC 4980
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Bromoisatin
CAS:Formula:C8H4BrNO2Purity:>97.0%(T)(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:226.035-Bromoisatin, 90+%
CAS:5-Bromoisatin is used in the synthesis of N-derivatives of 5-bromoisatin, N-substituted pyrroles, linear polyaryleneoxindoles, 5-bromodioxindole, cinchoninic acid derivatives, 3-hydroxyoxindole, S-benzyldithiocarbazate Schiff Bases, 5-bromooxindole and Morita-Baylis-Hillman adducts of isatin derivatFormula:C8H4BrNO2Purity:90+%Color and Shape:Powder, OrangeMolecular weight:226.035-Bromoindoline-2,3-dione
CAS:Formula:C8H4BrNO2Purity:98%Color and Shape:SolidMolecular weight:226.0269Ref: IN-DA003MK7
1g20.00€5g25.00€10g28.00€25g34.00€50g52.00€100g73.00€250g134.00€500g173.00€1kg288.00€5kg1,023.00€10kg2,082.00€25kg5,081.00€5-Bromoisatin
CAS:5-BromoisatinFormula:C8H4BrNO2Purity:≥95%Color and Shape:Orange Solid-PowderMolecular weight:226.026855-Bromoisatin
CAS:5-Bromoisatoic anhydride is a potential anticancer agent that contains nitrogen atoms. It inhibits the growth of cancer cells by binding to the enzyme acetylcholine, which is involved in the production of growth factors. The compound also inhibits the production of malonic acid, which is a metabolic disorder. 5-Bromoisatoic anhydride forms stable complexes with malonic acid and does not cause any adverse effects on normal cells.
Formula:C8H4BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:226.03 g/mol5-Bromo-1H-indole-2,3-dione
CAS:Formula:C8H4BrNO2Purity:95%Color and Shape:Solid, Yellow powderMolecular weight:226.0295-Bromoisatin
CAS:Controlled ProductApplications Indole derivative
Formula:C8H4BrNO2Color and Shape:NeatMolecular weight:226.03







