CAS 870002-28-1
:cyclopropyl-(2,6-dimethylphenyl)methanone
Description:
Cyclopropyl-(2,6-dimethylphenyl)methanone is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a 2,6-dimethylphenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits a relatively low molecular weight and is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the cyclopropyl group can impart distinctive reactivity, making it a subject of interest in synthetic organic chemistry. The 2,6-dimethylphenyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the carbonyl group is a key feature that can participate in various chemical reactions, such as nucleophilic addition. The compound may also exhibit interesting biological activities, making it relevant in medicinal chemistry. However, specific physical and chemical properties such as boiling point, melting point, and reactivity would require empirical data for precise characterization.
Formula:C12H14O
InChI:InChI=1/C12H14O/c1-8-4-3-5-9(2)11(8)12(13)10-6-7-10/h3-5,10H,6-7H2,1-2H3
SMILES:Cc1cccc(C)c1C(=O)C1CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.