CAS 870062-76-3

6-Chloro-5-fluoropyridin-3-ol

Description:

6-Chloro-5-fluoropyridin-3-ol is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both chlorine and fluorine atoms, as well as a hydroxyl group. The molecular structure features a chlorine atom at the 6-position and a fluorine atom at the 5-position of the pyridine ring, with a hydroxyl (-OH) group located at the 3-position. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. Its unique substitution pattern contributes to its potential reactivity and applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogens can influence the compound's electronic properties and biological activity, making it a subject of interest in various chemical research fields. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.

Formula: C₅H₃ClFNO

InChI: InChI=1/C5H3ClFNO/c6-5-4(7)1-3(9)2-8-5/h1-2,9H

SMILES: c1c(cnc(c1F)Cl)O

Synonyms:

• 3-Pyridinol, 6-Chloro-5-Fluoro-
• 2-Chloro-3-fluoro-5-hydroxypyridine

2-Chloro-3-fluoro-5-hydroxypyridine

CAS: 870062-76-3

Formula: C₅H₃ClFNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 147.5348

Ref: IN-DA0038DR

2-Chloro-3-fluoro-5-hydroxypyridine

CAS: 870062-76-3

2-Chloro-3-fluoro-5-hydroxypyridine

Purity: 99%

Molecular weight: 147.53g/mol

Ref: 54-PC445035

2-Chloro-3-fluoro-5-hydroxypyridine

CAS: 870062-76-3

Formula: C₅H₃ClFNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.53

Ref: 10-F076453