CAS 870063-53-9
:2-Chloro-5-fluoro-3-pyridinemethanamine
Description:
2-Chloro-5-fluoro-3-pyridinemethanamine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro group and a fluoro group attached to the pyridine ring, specifically at the 2 and 5 positions, respectively, while the methanamine group is attached at the 3-position. The presence of these halogen substituents can influence the compound's reactivity, polarity, and biological activity. Typically, such compounds may exhibit properties that make them useful in pharmaceuticals or agrochemicals. The molecular structure suggests potential for hydrogen bonding due to the amine group, which can enhance solubility in polar solvents. Additionally, the presence of halogens often contributes to the compound's stability and can affect its interaction with biological targets. Overall, 2-Chloro-5-fluoro-3-pyridinemethanamine is a compound of interest in various chemical and medicinal research contexts.
Formula:C6H6ClFN2
InChI:InChI=1S/C6H6ClFN2/c7-6-4(2-9)1-5(8)3-10-6/h1,3H,2,9H2
InChI key:InChIKey=ZVHCOUATUMIIIL-UHFFFAOYSA-N
SMILES:C(N)C1=C(Cl)N=CC(F)=C1
Synonyms:- (2-Chloro-5-fluoro-3-pyridyl)methanamine
- (2-Chloro-5-fluoropyridin-3-yl)methanamine
- 2-Chloro-5-fluoro-3-pyridinemethanamine
- [(2-Chloro-5-fluoropyridin-3-yl)methyl]amine
- 3-Pyridinemethanamine, 2-chloro-5-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
