CymitQuimica logo

CAS 870063-61-9

:

4-(Azidomethyl)-3-fluoropyridine

Description:
4-(Azidomethyl)-3-fluoropyridine is a chemical compound characterized by its unique functional groups and structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its basicity and reactivity. The presence of a fluorine atom at the 3-position of the pyridine ring enhances its electrophilic character, making it useful in various chemical reactions. The azidomethyl group at the 4-position introduces a highly reactive azide functional group, which can participate in click chemistry and other coupling reactions. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Additionally, the azide group is known for its potential in bioorthogonal reactions, allowing for selective labeling and functionalization in biological systems. Safety precautions should be taken when handling this compound, as azides can be sensitive and potentially explosive under certain conditions.
Formula:C6H5FN4
InChI:InChI=1S/C6H5FN4/c7-6-4-9-2-1-5(6)3-10-11-8/h1-2,4H,3H2
InChI key:InChIKey=ITHWLQZYSNZMES-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C=1C(F)=CN=CC1
Synonyms:
  • Pyridine, 4-(azidomethyl)-3-fluoro-
  • 4-(Azidomethyl)-3-fluoropyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.