
CAS 870064-86-1
:2-(2-Chlorophenyl)-3-pyridinecarbonitrile
Description:
2-(2-Chlorophenyl)-3-pyridinecarbonitrile, with the CAS number 870064-86-1, is an organic compound characterized by its unique structural features. It consists of a pyridine ring substituted with a cyano group and a chlorophenyl group. The presence of the cyano group (-C≡N) contributes to its potential reactivity and polarity, while the chlorophenyl moiety introduces halogen chemistry, which can influence the compound's electronic properties and interactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. Its chemical properties make it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a potential pharmacophore. Additionally, the chlorinated aromatic structure can impart specific biological activities, making it a candidate for further research in drug development or agrochemical applications. Safety and handling precautions should be observed due to the presence of the cyano group and chlorine atom, which can pose health risks.
Formula:C12H7ClN2
InChI:InChI=1S/C12H7ClN2/c13-11-6-2-1-5-10(11)12-9(8-14)4-3-7-15-12/h1-7H
InChI key:InChIKey=SUJOLWHLOQGRDP-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=CC=C1)C2=C(Cl)C=CC=C2
Synonyms:- 2-(2-Chlorophenyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 2-(2-chlorophenyl)-
- 2-(2-Chlorophenyl)nicotinonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
