CAS 87019-31-6
:carbomethoxyethylthioethyl 2-*acetamido-2-deoxy-4
Description:
Carbomethoxyethylthioethyl 2-acetamido-2-deoxy-4 is a chemical compound characterized by its complex structure, which includes functional groups such as carbomethoxy, thioether, and acetamido. This compound is part of a broader class of derivatives that may exhibit biological activity, particularly in pharmaceutical applications. The presence of the acetamido group suggests potential interactions with biological systems, possibly influencing its solubility and reactivity. The thioether linkage can enhance the compound's stability and may affect its pharmacokinetics. Additionally, the carbomethoxy group can contribute to the overall polarity of the molecule, impacting its ability to interact with various biological targets. The specific properties, such as melting point, solubility, and reactivity, would depend on the overall molecular structure and the arrangement of its functional groups. As with many chemical substances, safety and handling precautions are essential, particularly in laboratory settings, to mitigate any potential hazards associated with its use.
Formula:C20H35NO13S
InChI:InChI=1/C20H35NO13S/c1-9(24)21-13-15(27)18(34-20-17(29)16(28)14(26)10(7-22)32-20)11(8-23)33-19(13)31-4-6-35-5-3-12(25)30-2/h10-11,13-20,22-23,26-29H,3-8H2,1-2H3,(H,21,24)
SMILES:CC(=NC1C(C(C(CO)OC1OCCSCCC(=O)OC)OC1C(C(C(C(CO)O1)O)O)O)O)O
Synonyms:- methyl 3-[(2-{[2-(acetylamino)-2-deoxy-4-O-hexopyranosylhexopyranosyl]oxy}ethyl)sulfanyl]propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Carbomethoxyethylthioethyl 2-acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside
CAS:Carbomethoxyethylthioethyl 2-acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside is a glycosylide that is custom synthesized for a high purity, complex carbohydrate. It is modified with methylation and fluorination. Click modification can be done on this product to provide a more stable molecule. Carbomethoxyethylthioethyl 2-acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D -glucopyranoside has CAS No. 87019-31 -6 and can be used in the synthesis of other compounds.Formula:C20H35NO13SPurity:Min. 95%Molecular weight:529.56 g/mol

