CAS 870221-22-0

4-(2-chloropyridin-3-yl)-N-methylpyrimidin-2-amine

Description:

4-(2-Chloropyridin-3-yl)-N-methylpyrimidin-2-amine is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a chloropyridine moiety. This compound features a methyl group attached to the nitrogen of the pyrimidine, contributing to its basicity and potential reactivity. The presence of the chlorine atom on the pyridine ring enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound is typically used in medicinal chemistry and drug development due to its potential biological activity, particularly in targeting specific enzymes or receptors. Its solubility and stability in various solvents can vary, influencing its application in research and industry. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, this compound exemplifies the intricate design often found in pharmaceutical chemistry, where specific functional groups are tailored for desired interactions in biological systems.

Formula: C₁₀H₉ClN₄

InChI: InChI=1/C10H9ClN4/c1-12-10-14-6-4-8(15-10)7-3-2-5-13-9(7)11/h2-6H,1H3,(H,12,14,15)

SMILES: CN=c1[nH]ccc(c2cccnc2Cl)n1

Synonyms:

• 2-pyrimidinamine, 4-(2-chloro-3-pyridinyl)-N-methyl-

4-(2-Chloro-3-pyridinyl)-N-methyl-2-pyrimidinamine

CAS: 870221-22-0

Formula: C₁₀H₉ClN₄

Molecular weight: 220.6583

Ref: IN-DA00IEBI

4-(2-Chloro-3-pyridinyl)-N-methyl-2-pyrimidinamine

CAS: 870221-22-0

4-(2-Chloro-3-pyridinyl)-N-methyl-2-pyrimidinamine

Purity: ≥95%

Molecular weight: 220.66g/mol

Ref: 54-OR303893