CAS 870243-95-1

Methyl 4-bromo-6,7-dihydro-7-oxothieno[2,3-c]pyridine-2-carboxylate

Description:

Methyl 4-bromo-6,7-dihydro-7-oxothieno[2,3-c]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[2,3-c]pyridine core. This compound features a bromine substituent at the 4-position and a methyl ester functional group at the 2-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the oxo group at the 7-position enhances its electrophilic character, making it a candidate for various chemical transformations. Its unique structure may impart specific biological activities, which can be explored in drug discovery and development. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as light and moisture. As with many heterocycles, it may exhibit interesting pharmacological properties, warranting further investigation into its potential therapeutic uses. Safety data and handling precautions should be considered due to the presence of bromine, which can pose health risks.

Formula: C₉H₆BrNO₃S

InChI: InChI=1S/C9H6BrNO3S/c1-14-9(13)6-2-4-5(10)3-11-8(12)7(4)15-6/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=FAVYWEQWMCTDON-UHFFFAOYSA-N

SMILES: BrC=1C2=C(SC(C(OC)=O)=C2)C(=O)NC1

Synonyms:

• 4-Bromo-7-oxo-6,7-dihydrothieno[2,3-c]pyridine-2-carboxylic acid methyl ester
• Thieno[2,3-c]pyridine-2-carboxylic acid, 4-bromo-6,7-dihydro-7-oxo-, methyl ester
• Methyl 4-bromo-6,7-dihydro-7-oxothieno[2,3-c]pyridine-2-carboxylate