CAS 870244-34-1

3,5-Dibromo-4-cyanopyridine

Description:

3,5-Dibromo-4-cyanopyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and a cyano group. Its molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and reactivity. The presence of bromine atoms enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The cyano group (-C≡N) is a strong electron-withdrawing group, which can influence the compound's reactivity and polarity. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the formation of more complex molecules. Additionally, its physical properties, such as solubility and melting point, can vary based on the solvent and conditions used. Safety precautions should be taken when handling this compound, as brominated compounds can pose health risks, and the cyano group is toxic.

Formula: C₆H₂Br₂N₂

InChI: InChI=1/C6H2Br2N2/c7-5-2-10-3-6(8)4(5)1-9/h2-3H

SMILES: C(#N)c1c(cncc1Br)Br

Synonyms:

• 3,5-Dibromoisonicotinonitrile
• 4-Pyridinecarbonitrile, 3,5-Dibromo-
• 3,5-Dibromopyridine-4-Carbonitrile
• 3,5-Dibromo-Isonicotinonitrile

3,5-Dibromoisonicotinonitrile

CAS: 870244-34-1

Formula: C₆H₂Br₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 261.9015

Ref: IN-DA0036BE

3,5-Dibromoisonicotinonitrile

CAS: 870244-34-1

3,5-Dibromoisonicotinonitrile

Purity: 99%

Molecular weight: 261.90g/mol

Ref: 54-OR72126

3,5-Dibromo-4-cyanopyridine

CAS: 870244-34-1

Formula: C₆H₂Br₂N₂

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 261.904

Ref: 10-F050456