CAS 870287-01-7

6-(2,5-dichlorophenyl)-6-oxo-hexanoic acid

Description:

6-(2,5-Dichlorophenyl)-6-oxo-hexanoic acid, with the CAS number 870287-01-7, is a chemical compound characterized by its unique structure, which includes a hexanoic acid backbone substituted with a 2,5-dichlorophenyl group and a keto functional group. This compound typically exhibits properties associated with both carboxylic acids and ketones, such as acidity and potential reactivity in various chemical reactions. The presence of the dichlorophenyl moiety may impart specific biological activities or enhance lipophilicity, influencing its behavior in biological systems. The compound's molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, affecting its solubility in polar solvents. Additionally, the dichlorinated aromatic ring can contribute to the compound's stability and reactivity, making it of interest in pharmaceutical and agrochemical research. Overall, 6-(2,5-dichlorophenyl)-6-oxo-hexanoic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₂H₁₂Cl₂O₃

InChI: InChI=1/C12H12Cl2O3/c13-8-5-6-10(14)9(7-8)11(15)3-1-2-4-12(16)17/h5-7H,1-4H2,(H,16,17)