
CAS 87032-71-1
:α-(Aminomethyl)-2,2-dimethyl-1,3-dioxolane-4-methanol
Description:
α-(Aminomethyl)-2,2-dimethyl-1,3-dioxolane-4-methanol, with the CAS number 87032-71-1, is a chemical compound characterized by its unique structural features, including a dioxolane ring and an amino group. This compound typically exhibits properties associated with both amines and alcohols, which may influence its solubility in polar solvents like water and its reactivity in various chemical reactions. The presence of the dioxolane moiety suggests potential applications in organic synthesis, particularly in the formation of more complex molecules. Additionally, the amino group can participate in hydrogen bonding, enhancing its interactions with other molecules. The compound may also display biological activity, making it of interest in pharmaceutical research. Its stability, melting point, boiling point, and specific reactivity would depend on the surrounding conditions and the presence of other functional groups. Overall, α-(Aminomethyl)-2,2-dimethyl-1,3-dioxolane-4-methanol is a versatile compound with potential applications in both synthetic and medicinal chemistry.
Formula:C7H15NO3
InChI:InChI=1S/C7H15NO3/c1-7(2)10-4-6(11-7)5(9)3-8/h5-6,9H,3-4,8H2,1-2H3
InChI key:InChIKey=MKDRHMDHWIBVRH-UHFFFAOYSA-N
SMILES:C(CN)(O)C1OC(C)(C)OC1
Synonyms:- 2-Amino-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethan-1-ol
- 1,3-Dioxolane-4-methanol, α-(aminomethyl)-2,2-dimethyl-
- 2-Amino-1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanol
- α-(Aminomethyl)-2,2-dimethyl-1,3-dioxolane-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.