CAS 870459-91-9

(4-Chloro-2-pyridinyl)boronicacid

Description:

(4-Chloro-2-pyridinyl)boronic acid, with the CAS number 870459-91-9, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is substituted with a chlorine atom. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid functionality. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, which makes it useful in various applications such as organic synthesis, medicinal chemistry, and as a reagent in cross-coupling reactions. The presence of the chlorine atom in the pyridine ring can influence its reactivity and interaction with other chemical species. Additionally, (4-Chloro-2-pyridinyl)boronic acid may exhibit biological activity, making it of interest in pharmaceutical research. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions when working with boronic acids.

Formula: C₅H₅BClNO₂

Synonyms:

• (4-Chloro-2-Pyridinyl)Boronic Acid
• B-(4-Chloro-2-Pyridinyl)Boronic Acid

4-Chloropyridine-2-boronic acid

CAS: 870459-91-9

Formula: C₅H₅BClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 157.3627

Ref: IN-DA004NJ1

4-Chloropyridine-2-boronic acid

CAS: 870459-91-9

4-Chloropyridine-2-boronic acid

Purity: 95%

Molecular weight: 157.36g/mol

Ref: 54-OR360128

(4-Chloropyridin-2-yl)boronic acid

CAS: 870459-91-9

Formula: C₅H₅BClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.36

Ref: 10-F209221