CymitQuimica logo

CAS 870487-43-7

:

19-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-4,7,10,13-tetraoxa-16-azanonadecanoic acid hydrazide

Description:
The chemical substance known as "19-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-4,7,10,13-tetraoxa-16-azanonadecanoic acid hydrazide," with the CAS number 870487-43-7, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including hydrazide, which suggests potential reactivity and biological activity. The presence of tetraoxa and azanona moieties indicates that the compound may exhibit interesting properties related to solubility and stability. The pyrrole-derived segment contributes to its potential pharmacological properties, as pyrrole derivatives are often associated with various biological activities. Additionally, the compound's hydrazide functionality may facilitate interactions with biological targets, making it a candidate for further research in medicinal chemistry. Overall, this substance's intricate structure and diverse functional groups suggest it could have applications in pharmaceuticals or materials science, although specific biological or chemical properties would require empirical investigation to fully understand its behavior and potential uses.
Formula:C18H30N4O8
InChI:InChI=1S/C18H30N4O8/c19-21-16(24)4-7-27-9-11-29-13-14-30-12-10-28-8-5-20-15(23)3-6-22-17(25)1-2-18(22)26/h1-2H,3-14,19H2,(H,20,23)(H,21,24)
InChI key:InChIKey=QAUZYDFPKXWLHX-UHFFFAOYSA-N
SMILES:C(CC(NCCOCCOCCOCCOCCC(NN)=O)=O)N1C(=O)C=CC1=O
Synonyms:
  • 4,7,10,13-Tetraoxa-16-azanonadecanoic acid, 19-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-, hydrazide
  • 19-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-17-oxo-4,7,10,13-tetraoxa-16-azanonadecanoic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.