CymitQuimica logo

CAS 870521-33-8

:

2-Morpholinopyrimidin-5-ylboronic acid

Description:
2-Morpholinopyrimidin-5-ylboronic acid is a boronic acid derivative characterized by the presence of a pyrimidine ring and a morpholine moiety. This compound typically features a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The morpholine ring contributes to its solubility and potential biological activity. The compound is often utilized in the development of pharmaceuticals, particularly in the design of kinase inhibitors and other therapeutic agents targeting specific biological pathways. Its structural features may influence its reactivity, stability, and interaction with biological targets. Additionally, the presence of the boronic acid group allows for participation in cross-coupling reactions, which are valuable in the synthesis of complex organic molecules. Overall, 2-Morpholinopyrimidin-5-ylboronic acid is a versatile compound with significant implications in both research and drug development.
Formula:C8H12BN3O3
InChI:InChI=1/C8H12BN3O3/c13-9(14)7-5-10-8(11-6-7)12-1-3-15-4-2-12/h5-6,13-14H,1-4H2
InChI key:KFYQOIHLZBDFBU-UHFFFAOYSA-N
SMILES:C1COCCN1c1ncc(cn1)B(O)O
Synonyms:
  • [2-(4-Morpholinyl)-5-pyrimidinyl]boronic acid
Found 4 products.