CymitQuimica logo

CAS 870552-28-6

:

2-Hydroxy-α,α-dimethylbenzeneacetonitrile

Description:
2-Hydroxy-α,α-dimethylbenzeneacetonitrile, also known by its CAS number 870552-28-6, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a benzene ring. This compound features a dimethyl substitution on the benzene ring, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The hydroxyl group imparts polar characteristics, making the compound more soluble in polar solvents, while the nitrile group can participate in various chemical reactions, including nucleophilic additions. The presence of the dimethyl groups can influence the steric hindrance and reactivity of the molecule. This compound may be of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential as an intermediate in chemical reactions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-10(2,7-11)8-5-3-4-6-9(8)12/h3-6,12H,1-2H3
InChI key:InChIKey=VUBAUGSBVVLEJI-UHFFFAOYSA-N
SMILES:C(C#N)(C)(C)C1=C(O)C=CC=C1
Synonyms:
  • 2-Hydroxy-α,α-dimethylbenzeneacetonitrile
  • Benzeneacetonitrile, 2-hydroxy-α,α-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.