CAS 870563-60-3
:1-(4-fluoro-2-methoxyphenyl)methanamine
Description:
1-(4-Fluoro-2-methoxyphenyl)methanamine, with the CAS number 870563-60-3, is an organic compound characterized by its amine functional group and a substituted aromatic ring. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its unique chemical properties, including potential variations in polarity and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amine group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications on the aromatic ring can influence biological activity. Additionally, the presence of the methoxy group may enhance lipophilicity, affecting the compound's pharmacokinetics. Safety and handling considerations should be taken into account, as with many amines, due to potential toxicity and reactivity. Overall, 1-(4-fluoro-2-methoxyphenyl)methanamine is a compound of interest in various chemical research fields, particularly in drug discovery and development.
Formula:C8H10FNO
InChI:InChI=1/C8H10FNO/c1-11-8-4-7(9)3-2-6(8)5-10/h2-4H,5,10H2,1H3
SMILES:COc1cc(ccc1CN)F
Synonyms:- benzenemethanamine, 4-fluoro-2-methoxy-4-Fluoro-2-Methoxybenzylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Fluoro-2-methoxybenzylamine, 97%
CAS:As pharmaceutical intermediate. As a metabolite of Capsaicin. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referenceFormula:C8H10FNOPurity:97%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:155.174-Fluoro-2-methoxybenzylamine
CAS:Formula:C8H10FNOPurity:97%Color and Shape:LiquidMolecular weight:155.1695(4-Fluoro- 2-methoxy-phenyl) methanamine
CAS:(4-Fluoro- 2-methoxy-phenyl) methanaminePurity:95%Molecular weight:155.17g/mol4-FLUORO-2-METHOXYBENZYLAMINE
CAS:Formula:C8H10FNOPurity:95%Color and Shape:LiquidMolecular weight:155.172



