CymitQuimica logo

CAS 87060-71-7

:

N-(3-Acetylphenyl)-4-pyridinecarboxamide

Description:
N-(3-Acetylphenyl)-4-pyridinecarboxamide, with the CAS number 87060-71-7, is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its potential biological activity. The presence of the acetyl group attached to the phenyl ring enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The molecular structure suggests that it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic rings. Its synthesis typically involves standard organic reactions, such as acylation and amidation. As with many organic compounds, safety data should be consulted for handling and usage, as well as potential environmental impacts.
Formula:C14H12N2O2
InChI:InChI=1S/C14H12N2O2/c1-10(17)12-3-2-4-13(9-12)16-14(18)11-5-7-15-8-6-11/h2-9H,1H3,(H,16,18)
InChI key:InChIKey=KRJADIRBSSTLHL-UHFFFAOYSA-N
SMILES:N(C(=O)C=1C=CN=CC1)C2=CC(C(C)=O)=CC=C2
Synonyms:
  • N-(3-Acetylphenyl)-4-pyridinecarboxamide
  • 4-Pyridinecarboxamide, N-(3-acetylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.