
CAS 87064-17-3
:(4E,8E)-4,8-Dimethyl-2-oxabicyclo[9.3.1]pentadeca-1(15),4,8,11,13-pentaen-12-ol
Description:
(4E,8E)-4,8-Dimethyl-2-oxabicyclo[9.3.1]pentadeca-1(15),4,8,11,13-pentaen-12-ol, with CAS number 87064-17-3, is a complex organic compound characterized by its bicyclic structure and multiple double bonds. This compound features a unique oxabicyclic framework, which incorporates an oxygen atom into the bicyclic system, contributing to its reactivity and potential applications in organic synthesis. The presence of five conjugated double bonds enhances its electronic properties, making it a candidate for various photochemical reactions. Additionally, the hydroxyl group (-OH) at the 12th position introduces polarity, influencing its solubility and interaction with other molecules. The specific stereochemistry indicated by the (4E,8E) configuration suggests that the compound may exhibit distinct optical properties, which can be important in fields such as materials science and pharmaceuticals. Overall, this compound's structural complexity and functional groups make it a subject of interest for further research in organic chemistry and potential applications in various chemical industries.
Formula:C16H20O2
InChI:InChI=1S/C16H20O2/c1-12-4-3-5-13(2)11-18-15-8-9-16(17)14(10-15)7-6-12/h5-6,8-10,17H,3-4,7,11H2,1-2H3/b12-6+,13-5+
InChI key:InChIKey=BSXTWYDVYNXVHH-YKNDAMCPSA-N
SMILES:OC1=C2C=C(C=C1)OC\C(\C)=C\CC\C(\C)=C\C2
Synonyms:- (4E,8E)-4,8-Dimethyl-2-oxabicyclo[9.3.1]pentadeca-1(15),4,8,11,13-pentaen-12-ol
- 2-Oxabicyclo[9.3.1]pentadeca-1(15),4,8,11,13-pentaen-12-ol, 4,8-dimethyl-, (4E,8E)-
- 2-Oxabicyclo[9.3.1]pentadeca-1(15),4,8,11,13-pentaen-12-ol, 4,8-dimethyl-, (E,E)-
- Arnebinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Arnebinol
CAS:Arnebinol has prostaglandin biosynthesis inhibitory activity.Formula:C16H20O2Color and Shape:SolidMolecular weight:244.33
