CAS 870692-83-4

4-(4-Morpholinylsulfonyl)-1H-pyrrole-2-carboxylic acid hydrazide

Description:

4-(4-Morpholinylsulfonyl)-1H-pyrrole-2-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrrole ring, a carboxylic acid functional group, and a hydrazide moiety. The presence of the morpholinylsulfonyl group enhances its solubility and potential reactivity, making it of interest in medicinal chemistry and drug development. This compound may exhibit biological activity due to its ability to interact with various biological targets, potentially influencing pathways related to inflammation or cancer. Its hydrazide functionality can participate in various chemical reactions, including hydrazone formation and coupling reactions, which are valuable in synthetic organic chemistry. The compound's stability, solubility, and reactivity can be influenced by factors such as pH and the presence of other functional groups. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and applications.

Formula: C₉H₁₄N₄O₄S

InChI: InChI=1S/C9H14N4O4S/c10-12-9(14)8-5-7(6-11-8)18(15,16)13-1-3-17-4-2-13/h5-6,11H,1-4,10H2,(H,12,14)

InChI key: InChIKey=BVCAJCOENAMUSV-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C=1C=C(C(NN)=O)NC1)N2CCOCC2

Synonyms:

• 4-(4-Morpholinylsulfonyl)-1H-pyrrole-2-carboxylic acid hydrazide
• 1H-Pyrrole-2-carboxylic acid, 4-(4-morpholinylsulfonyl)-, hydrazide