CAS 870693-02-0

2-[(2,3-Dihydro-1,4-benzodioxin-6-yl)thio]-3-pyridinecarboxylic acid

Description:

2-[(2,3-Dihydro-1,4-benzodioxin-6-yl)thio]-3-pyridinecarboxylic acid, with the CAS number 870693-02-0, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a benzodioxin moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the thioether linkage contributes to its reactivity, possibly allowing for interactions with various biological targets. The carboxylic acid functional group may impart acidic properties, influencing its behavior in different pH environments. Additionally, compounds of this nature are often investigated for their potential pharmacological activities, including anti-inflammatory or antimicrobial effects. The specific stereochemistry and substituents can significantly affect its biological activity and interactions, making it a subject of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific applications.

Formula: C₁₄H₁₁NO₄S

InChI: InChI=1S/C14H11NO4S/c16-14(17)10-2-1-5-15-13(10)20-9-3-4-11-12(8-9)19-7-6-18-11/h1-5,8H,6-7H2,(H,16,17)

InChI key: InChIKey=APMUPXDFIZEBRT-UHFFFAOYSA-N

SMILES: S(C=1C=C2C(=CC1)OCCO2)C3=C(C(O)=O)C=CC=N3

Synonyms:

• 2-[(2,3-Dihydro-1,4-benzodioxin-6-yl)thio]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-[(2,3-dihydro-1,4-benzodioxin-6-yl)thio]-