CymitQuimica logo

CAS 870693-13-3

:

6-Amino-1,3-dimethyl-5-(1-piperazinyl)-2,4(1H,3H)-pyrimidinedione

Description:
6-Amino-1,3-dimethyl-5-(1-piperazinyl)-2,4(1H,3H)-pyrimidinedione is a chemical compound characterized by its pyrimidinedione core structure, which features a 1,3-dimethyl substitution and an amino group at the 6-position. The presence of a piperazinyl group at the 5-position enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as solubility in polar solvents, which is common for many pyrimidine derivatives. Its molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The compound may also display a range of pharmacological effects, although specific biological activities would depend on further empirical studies. Additionally, its CAS number, 870693-13-3, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and development. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H17N5O2
InChI:InChI=1S/C10H17N5O2/c1-13-8(11)7(9(16)14(2)10(13)17)15-5-3-12-4-6-15/h12H,3-6,11H2,1-2H3
InChI key:InChIKey=OPTHSSHXXDHLHK-UHFFFAOYSA-N
SMILES:NC1=C(C(=O)N(C)C(=O)N1C)N2CCNCC2
Synonyms:
  • 6-Amino-1,3-dimethyl-5-(piperazin-1-yl)-1,2,3,4-tetrahydropyrimidine-2,4-dione
  • 2,4(1H,3H)-Pyrimidinedione, 6-amino-1,3-dimethyl-5-(1-piperazinyl)-
  • 6-Amino-1,3-dimethyl-5-(1-piperazinyl)-2,4(1H,3H)-pyrimidinedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.